About 1-methoxy-2-(nitromethylidene)-1,3-diazinane
1-methoxy-2-(nitromethylidene)-1,3-diazinane (PubChem CID 67796370) has the molecular formula C6H11N3O3
and a molecular weight of 173.17 g/mol. Its IUPAC name is 1-methoxy-2-(nitromethylidene)-1,3-diazinane.
Molecular Properties
| Compound Name | 1-methoxy-2-(nitromethylidene)-1,3-diazinane |
| PubChem CID | 67796370 |
| Molecular Formula | C6H11N3O3 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 1-methoxy-2-(nitromethylidene)-1,3-diazinane |
| SMILES | CON1CCCNC1=C[N+](=O)[O-] |
| InChI | InChI=1S/C6H11N3O3/c1-12-8-4-2-3-7-6(8)5-9(10)11/h5,7H,2-4H2,1H3 |
| InChIKey | VCNQAWPQXQAGLA-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-2-(nitromethylidene)-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-(nitromethylidene)-1,3-diazinane?
The IUPAC name of 1-methoxy-2-(nitromethylidene)-1,3-diazinane (CID 67796370) is 1-methoxy-2-(nitromethylidene)-1,3-diazinane.
What is the SMILES notation for 1-methoxy-2-(nitromethylidene)-1,3-diazinane?
The canonical SMILES for 1-methoxy-2-(nitromethylidene)-1,3-diazinane is CON1CCCNC1=C[N+](=O)[O-].
What is the InChIKey of 1-methoxy-2-(nitromethylidene)-1,3-diazinane?
The InChIKey is VCNQAWPQXQAGLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3O3/c1-12-8-4-2-3-7-6(8)5-9(10)11/h5,7H,2-4H2,1H3.
What are the key properties of 1-methoxy-2-(nitromethylidene)-1,3-diazinane?
1-methoxy-2-(nitromethylidene)-1,3-diazinane has a molecular weight of 173.17 g/mol, XLogP of -0.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-(nitromethylidene)-1,3-diazinane is sourced from PubChem (CID 67796370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).