C13H15NO3S — CID 67796779
7-methoxy-3-propoxy-1-benzothiophene-2-carboxamide (PubChem CID 67796779) has the molecular formula C13H15NO3S and a molecular weight of 265.33 g/mol. Its IUPAC name is 7-methoxy-3-propoxy-1-benzothiophene-2-carboxamide.
| Compound Name | 7-methoxy-3-propoxy-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 67796779 |
| Molecular Formula | C13H15NO3S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | 7-methoxy-3-propoxy-1-benzothiophene-2-carboxamide |
| SMILES | CCCOc1c(C(N)=O)sc2c(OC)cccc12 |
| InChI | InChI=1S/C13H15NO3S/c1-3-7-17-10-8-5-4-6-9(16-2)11(8)18-12(10)13(14)15/h4-6H,3,7H2,1-2H3,(H2,14,15) |
| InChIKey | HPMHBROQNWLRQE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |