C29H39FO3Si — CID 67797017
methyl (Z)-6-[(1R,2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluorocyclopentyl]hex-4-enoate (PubChem CID 67797017) has the molecular formula C29H39FO3Si and a molecular weight of 482.71 g/mol. Its IUPAC name is methyl (Z)-6-[(1R,2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluorocyclopentyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1R,2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluorocyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 67797017 |
| Molecular Formula | C29H39FO3Si |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | methyl (Z)-6-[(1R,2S,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-fluorocyclopentyl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@H]1[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CC[C@H]1F |
| InChI | InChI=1S/C29H39FO3Si/c1-29(2,3)34(24-14-8-5-9-15-24,25-16-10-6-11-17-25)33-22-23-20-21-27(30)26(23)18-12-7-13-19-28(31)32-4/h5-12,14-17,23,26-27H,13,18-22H2,1-4H3/b12-7-/t23-,26-,27-/m1/s1 |
| InChIKey | RGDYTXDCVMUMSV-FTGGRHGCSA-N |
| XLogP | 5.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|