C20H26ClFN2O3 — CID 67797101
methyl (Z)-6-[(1R,2S,5R)-2-[[(4-chlorophenyl)carbamoylamino]methyl]-5-fluorocyclopentyl]hex-4-enoate (PubChem CID 67797101) has the molecular formula C20H26ClFN2O3 and a molecular weight of 396.89 g/mol. Its IUPAC name is methyl (Z)-6-[(1R,2S,5R)-2-[[(4-chlorophenyl)carbamoylamino]methyl]-5-fluorocyclopentyl]hex-4-enoate.
| Compound Name | methyl (Z)-6-[(1R,2S,5R)-2-[[(4-chlorophenyl)carbamoylamino]methyl]-5-fluorocyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 67797101 |
| Molecular Formula | C20H26ClFN2O3 |
| Molecular Weight | 396.89 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | methyl (Z)-6-[(1R,2S,5R)-2-[[(4-chlorophenyl)carbamoylamino]methyl]-5-fluorocyclopentyl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C\C[C@@H]1[C@@H](CNC(=O)Nc2ccc(Cl)cc2)CC[C@H]1F |
| InChI | InChI=1S/C20H26ClFN2O3/c1-27-19(25)6-4-2-3-5-17-14(7-12-18(17)22)13-23-20(26)24-16-10-8-15(21)9-11-16/h2-3,8-11,14,17-18H,4-7,12-13H2,1H3,(H2,23,24,26)/b3-2-/t14-,17-,18-/m1/s1 |
| InChIKey | KSMMXCKCPNQZOJ-RMAKXMGUSA-N |
| XLogP | 4.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.89 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|