C24H26O3 — CID 67797905
(2R,4R)-2-ethyl-4-[3-(naphthalen-2-ylmethoxy)phenyl]oxan-4-ol (PubChem CID 67797905) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is (2R,4R)-2-ethyl-4-[3-(naphthalen-2-ylmethoxy)phenyl]oxan-4-ol.
| Compound Name | (2R,4R)-2-ethyl-4-[3-(naphthalen-2-ylmethoxy)phenyl]oxan-4-ol |
|---|---|
| PubChem CID | 67797905 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | (2R,4R)-2-ethyl-4-[3-(naphthalen-2-ylmethoxy)phenyl]oxan-4-ol |
| SMILES | CC[C@@H]1C[C@@](O)(c2cccc(OCc3ccc4ccccc4c3)c2)CCO1 |
| InChI | InChI=1S/C24H26O3/c1-2-22-16-24(25,12-13-26-22)21-8-5-9-23(15-21)27-17-18-10-11-19-6-3-4-7-20(19)14-18/h3-11,14-15,22,25H,2,12-13,16-17H2,1H3/t22-,24-/m1/s1 |
| InChIKey | FVSUJFXEAYCQIR-ISKFKSNPSA-N |
| XLogP | 5.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |