C16H25NO4Si — CID 67798330
(1S,8aS,8bR)-2-oxo-1-[(1R)-1-trimethylsilyloxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid (PubChem CID 67798330) has the molecular formula C16H25NO4Si and a molecular weight of 323.47 g/mol. Its IUPAC name is (1S,8aS,8bR)-2-oxo-1-[(1R)-1-trimethylsilyloxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid.
| Compound Name | (1S,8aS,8bR)-2-oxo-1-[(1R)-1-trimethylsilyloxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 67798330 |
| Molecular Formula | C16H25NO4Si |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | (1S,8aS,8bR)-2-oxo-1-[(1R)-1-trimethylsilyloxyethyl]-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
| SMILES | C[C@@H](O[Si](C)(C)C)[C@H]1C(=O)N2C(C(=O)O)=C3CCCC[C@@H]3[C@H]12 |
| InChI | InChI=1S/C16H25NO4Si/c1-9(21-22(2,3)4)12-13-10-7-5-6-8-11(10)14(16(19)20)17(13)15(12)18/h9-10,12-13H,5-8H2,1-4H3,(H,19,20)/t9-,10+,12-,13-/m1/s1 |
| InChIKey | MYNIMWHOYPVAHM-LYIQGSDWSA-N |
| XLogP | 2.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|