C20H25NO — CID 67798545
2-[(8S,13S,14S,17R)-17-hydroxy-13-methyl-2,3,6,7,8,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]acetonitrile (PubChem CID 67798545) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 2-[(8S,13S,14S,17R)-17-hydroxy-13-methyl-2,3,6,7,8,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]acetonitrile.
| Compound Name | 2-[(8S,13S,14S,17R)-17-hydroxy-13-methyl-2,3,6,7,8,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]acetonitrile |
|---|---|
| PubChem CID | 67798545 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 2-[(8S,13S,14S,17R)-17-hydroxy-13-methyl-2,3,6,7,8,14,15,16-octahydro-1H-cyclopenta[a]phenanthren-17-yl]acetonitrile |
| SMILES | C[C@]12C=CC3=C4CCCC=C4CC[C@H]3[C@@H]1CC[C@@]2(O)CC#N |
| InChI | InChI=1S/C20H25NO/c1-19-10-8-16-15-5-3-2-4-14(15)6-7-17(16)18(19)9-11-20(19,22)12-13-21/h4,8,10,17-18,22H,2-3,5-7,9,11-12H2,1H3/t17-,18+,19+,20-/m1/s1 |
| InChIKey | LTTDIPBTKXDICI-FUMNGEBKSA-N |
| XLogP | 4.43 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |