C20H26O6 — CID 67798629
(6R,7R,14S)-14-[hydroxy(phenyl)methyl]-14-methyl-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-one (PubChem CID 67798629) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is (6R,7R,14S)-14-[hydroxy(phenyl)methyl]-14-methyl-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-one.
| Compound Name | (6R,7R,14S)-14-[hydroxy(phenyl)methyl]-14-methyl-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-one |
|---|---|
| PubChem CID | 67798629 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | (6R,7R,14S)-14-[hydroxy(phenyl)methyl]-14-methyl-5,12,13,16-tetraoxadispiro[5.0.57.46]hexadecan-15-one |
| SMILES | C[C@@]1(C(O)c2ccccc2)O[C@]2(CCCCO2)[C@@]2(CCCCO2)OC1=O |
| InChI | InChI=1S/C20H26O6/c1-18(16(21)15-9-3-2-4-10-15)17(22)25-19(11-5-7-13-23-19)20(26-18)12-6-8-14-24-20/h2-4,9-10,16,21H,5-8,11-14H2,1H3/t16?,18-,19+,20+/m0/s1 |
| InChIKey | ACNUASFNWRPCFR-PKEJDKSOSA-N |
| XLogP | 2.85 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |