C15H19N — CID 67798807
1,3,5-trimethyl-4-phenylcyclohexa-2,4-dien-1-amine (PubChem CID 67798807) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 1,3,5-trimethyl-4-phenylcyclohexa-2,4-dien-1-amine.
| Compound Name | 1,3,5-trimethyl-4-phenylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 67798807 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 1,3,5-trimethyl-4-phenylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1=CC(C)(N)CC(C)=C1c1ccccc1 |
| InChI | InChI=1S/C15H19N/c1-11-9-15(3,16)10-12(2)14(11)13-7-5-4-6-8-13/h4-9H,10,16H2,1-3H3 |
| InChIKey | XSMVRPSKLPNYLE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |