C13H13F3N6O6S — CID 67799252
[(1S,10R)-5-(1-methyltetrazol-5-yl)sulfanyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid (PubChem CID 67799252) has the molecular formula C13H13F3N6O6S and a molecular weight of 438.34 g/mol. Its IUPAC name is [(1S,10R)-5-(1-methyltetrazol-5-yl)sulfanyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1S,10R)-5-(1-methyltetrazol-5-yl)sulfanyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67799252 |
| Molecular Formula | C13H13F3N6O6S |
| Molecular Weight | 438.34 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [(1S,10R)-5-(1-methyltetrazol-5-yl)sulfanyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid |
| SMILES | Cn1nnnc1SC1=C(OC(=O)O)N2C(=O)[C@H]3NCCC1[C@H]32.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H12N6O4S.C2HF3O2/c1-16-10(13-14-15-16)22-7-4-2-3-12-5-6(4)17(8(5)18)9(7)21-11(19)20;3-2(4,5)1(6)7/h4-6,12H,2-3H2,1H3,(H,19,20);(H,6,7)/t4?,5-,6+;/m0./s1 |
| InChIKey | XJQHWLGBMZDZLM-DHSANDOESA-N |
| XLogP | 0.00 |
| TPSA | 159.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.34 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |