About 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid
5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid (PubChem CID 67799415) has the molecular formula C4H4BrN3O2
and a molecular weight of 206.00 g/mol. Its IUPAC name is 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid |
| PubChem CID | 67799415 |
| Molecular Formula | C4H4BrN3O2 |
| Molecular Weight | 206.00 g/mol |
| Exact Mass | 204.95 |
| IUPAC Name | 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid |
| SMILES | Cn1nc(Br)nc1C(=O)O |
| InChI | InChI=1S/C4H4BrN3O2/c1-8-2(3(9)10)6-4(5)7-8/h1H3,(H,9,10) |
| InChIKey | GTGDJBNAAKXYGI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.00 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid?
The IUPAC name of 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid (CID 67799415) is 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid.
What is the SMILES notation for 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid?
The canonical SMILES for 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid is Cn1nc(Br)nc1C(=O)O.
What is the InChIKey of 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid?
The InChIKey is GTGDJBNAAKXYGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4BrN3O2/c1-8-2(3(9)10)6-4(5)7-8/h1H3,(H,9,10).
What are the key properties of 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid?
5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid has a molecular weight of 206.00 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-methyl-1,2,4-triazole-3-carboxylic acid is sourced from PubChem (CID 67799415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).