C13H14F3N3O7S — CID 67799489
[(1S,10R)-5-(2-amino-2-oxoethyl)sulfanyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid (PubChem CID 67799489) has the molecular formula C13H14F3N3O7S and a molecular weight of 413.33 g/mol. Its IUPAC name is [(1S,10R)-5-(2-amino-2-oxoethyl)sulfanyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1S,10R)-5-(2-amino-2-oxoethyl)sulfanyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67799489 |
| Molecular Formula | C13H14F3N3O7S |
| Molecular Weight | 413.33 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | [(1S,10R)-5-(2-amino-2-oxoethyl)sulfanyl-2-oxo-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid |
| SMILES | NC(=O)CSC1=C(OC(=O)O)N2C(=O)[C@H]3NCCC1[C@H]32.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C11H13N3O5S.C2HF3O2/c12-5(15)3-20-8-4-1-2-13-6-7(4)14(9(6)16)10(8)19-11(17)18;3-2(4,5)1(6)7/h4,6-7,13H,1-3H2,(H2,12,15)(H,17,18);(H,6,7)/t4?,6-,7+;/m0./s1 |
| InChIKey | PORKYSIAQUAMBU-IZGBAWNSSA-N |
| XLogP | -0.10 |
| TPSA | 159.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |