About 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile
4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile (PubChem CID 67799524) has the molecular formula C20H16F2N4O
and a molecular weight of 366.37 g/mol. Its IUPAC name is 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile |
| PubChem CID | 67799524 |
| Molecular Formula | C20H16F2N4O |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile |
| SMILES | CC(=Cc1ccc(C#N)cc1)C(O)(Cc1cn[nH]n1)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H16F2N4O/c1-13(8-14-2-4-15(11-23)5-3-14)20(27,10-17-12-24-26-25-17)18-7-6-16(21)9-19(18)22/h2-9,12,27H,10H2,1H3,(H,24,25,26) |
| InChIKey | YFYFDHLHYOFQRO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile?
The IUPAC name of 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile (CID 67799524) is 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile.
What is the SMILES notation for 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile?
The canonical SMILES for 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile is CC(=Cc1ccc(C#N)cc1)C(O)(Cc1cn[nH]n1)c1ccc(F)cc1F.
What is the InChIKey of 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile?
The InChIKey is YFYFDHLHYOFQRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16F2N4O/c1-13(8-14-2-4-15(11-23)5-3-14)20(27,10-17-12-24-26-25-17)18-7-6-16(21)9-19(18)22/h2-9,12,27H,10H2,1H3,(H,24,25,26).
What are the key properties of 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile?
4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile has a molecular weight of 366.37 g/mol, XLogP of 3.49, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(2,4-difluorophenyl)-3-hydroxy-2-methyl-4-(2H-triazol-4-yl)but-1-enyl]benzonitrile is sourced from PubChem (CID 67799524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).