C14H14F3N5O6S — CID 67800388
[(1S,10R)-2-oxo-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid (PubChem CID 67800388) has the molecular formula C14H14F3N5O6S and a molecular weight of 437.36 g/mol. Its IUPAC name is [(1S,10R)-2-oxo-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid.
| Compound Name | [(1S,10R)-2-oxo-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67800388 |
| Molecular Formula | C14H14F3N5O6S |
| Molecular Weight | 437.36 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | [(1S,10R)-2-oxo-5-(1H-1,2,4-triazol-5-ylsulfanylmethyl)-3,9-diazatricyclo[4.3.1.03,10]dec-4-en-4-yl] hydrogen carbonate;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)OC1=C(CSc2ncn[nH]2)C2CCN[C@@H]3C(=O)N1[C@H]23 |
| InChI | InChI=1S/C12H13N5O4S.C2HF3O2/c18-9-7-8-5(1-2-13-7)6(3-22-11-14-4-15-16-11)10(17(8)9)21-12(19)20;3-2(4,5)1(6)7/h4-5,7-8,13H,1-3H2,(H,19,20)(H,14,15,16);(H,6,7)/t5?,7-,8+;/m0./s1 |
| InChIKey | UQFYYIOHEYIGTH-XYEIPIPASA-N |
| XLogP | 0.64 |
| TPSA | 157.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |