C17H25NO3 — CID 67800573
1-[(4aR,10aR)-6-methoxy-4-methyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-9-yl]propan-1-ol (PubChem CID 67800573) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 1-[(4aR,10aR)-6-methoxy-4-methyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-9-yl]propan-1-ol.
| Compound Name | 1-[(4aR,10aR)-6-methoxy-4-methyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-9-yl]propan-1-ol |
|---|---|
| PubChem CID | 67800573 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 1-[(4aR,10aR)-6-methoxy-4-methyl-2,3,4a,5,10,10a-hexahydrobenzo[g][1,4]benzoxazin-9-yl]propan-1-ol |
| SMILES | CCC(O)c1ccc(OC)c2c1C[C@H]1OCCN(C)[C@@H]1C2 |
| InChI | InChI=1S/C17H25NO3/c1-4-15(19)11-5-6-16(20-3)13-9-14-17(10-12(11)13)21-8-7-18(14)2/h5-6,14-15,17,19H,4,7-10H2,1-3H3/t14-,15?,17-/m1/s1 |
| InChIKey | RGOTZUBNDBELJY-XZDBBAETSA-N |
| XLogP | 1.94 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |