About 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea
1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea (PubChem CID 67800587) has the molecular formula C15H9N5O5
and a molecular weight of 339.27 g/mol. Its IUPAC name is 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea.
Molecular Properties
| Compound Name | 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea |
| PubChem CID | 67800587 |
| Molecular Formula | C15H9N5O5 |
| Molecular Weight | 339.27 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea |
| SMILES | O=C(NN=c1c(=O)c2cccc([N+](=O)[O-])c2c1=O)Nc1ccncc1 |
| InChI | InChI=1S/C15H9N5O5/c21-13-9-2-1-3-10(20(24)25)11(9)14(22)12(13)18-19-15(23)17-8-4-6-16-7-5-8/h1-7H,(H2,16,17,19,23) |
| InChIKey | XUZMOFGPCWXDQU-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 143.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.27 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea?
The IUPAC name of 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea (CID 67800587) is 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea.
What is the SMILES notation for 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea?
The canonical SMILES for 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea is O=C(NN=c1c(=O)c2cccc([N+](=O)[O-])c2c1=O)Nc1ccncc1.
What is the InChIKey of 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea?
The InChIKey is XUZMOFGPCWXDQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N5O5/c21-13-9-2-1-3-10(20(24)25)11(9)14(22)12(13)18-19-15(23)17-8-4-6-16-7-5-8/h1-7H,(H2,16,17,19,23).
What are the key properties of 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea?
1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea has a molecular weight of 339.27 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4-nitro-1,3-dioxoinden-2-ylidene)amino]-3-pyridin-4-ylurea is sourced from PubChem (CID 67800587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).