About iron;10H-1,10-phenanthrolin-4a-amine
iron;10H-1,10-phenanthrolin-4a-amine (PubChem CID 67802010) has the molecular formula C12H11FeN3
and a molecular weight of 253.09 g/mol. Its IUPAC name is iron;10H-1,10-phenanthrolin-4a-amine.
Molecular Properties
| Compound Name | iron;10H-1,10-phenanthrolin-4a-amine |
| PubChem CID | 67802010 |
| Molecular Formula | C12H11FeN3 |
| Molecular Weight | 253.09 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | iron;10H-1,10-phenanthrolin-4a-amine |
| SMILES | NC12C=CC=NC1=C1NC=CC=C1C=C2.[Fe] |
| InChI | InChI=1S/C12H11N3.Fe/c13-12-5-2-8-15-11(12)10-9(4-6-12)3-1-7-14-10;/h1-8,14H,13H2; |
| InChIKey | XXJZAKOVWKYBHP-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.09 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iron;10H-1,10-phenanthrolin-4a-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;10H-1,10-phenanthrolin-4a-amine?
The IUPAC name of iron;10H-1,10-phenanthrolin-4a-amine (CID 67802010) is iron;10H-1,10-phenanthrolin-4a-amine.
What is the SMILES notation for iron;10H-1,10-phenanthrolin-4a-amine?
The canonical SMILES for iron;10H-1,10-phenanthrolin-4a-amine is NC12C=CC=NC1=C1NC=CC=C1C=C2.[Fe].
What is the InChIKey of iron;10H-1,10-phenanthrolin-4a-amine?
The InChIKey is XXJZAKOVWKYBHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3.Fe/c13-12-5-2-8-15-11(12)10-9(4-6-12)3-1-7-14-10;/h1-8,14H,13H2;.
What are the key properties of iron;10H-1,10-phenanthrolin-4a-amine?
iron;10H-1,10-phenanthrolin-4a-amine has a molecular weight of 253.09 g/mol, XLogP of 1.15, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for iron;10H-1,10-phenanthrolin-4a-amine is sourced from PubChem (CID 67802010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).