About 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one
6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one (PubChem CID 67802332) has the molecular formula C9H9FO3
and a molecular weight of 184.17 g/mol. Its IUPAC name is 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one |
| PubChem CID | 67802332 |
| Molecular Formula | C9H9FO3 |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=C(O)C=CC1(O)C1CC1F |
| InChI | InChI=1S/C9H9FO3/c10-7-4-6(7)9(13)2-1-5(11)3-8(9)12/h1-3,6-7,11,13H,4H2 |
| InChIKey | WKGSUNWPWFJOJC-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one?
The IUPAC name of 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one (CID 67802332) is 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one is O=C1C=C(O)C=CC1(O)C1CC1F.
What is the InChIKey of 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one?
The InChIKey is WKGSUNWPWFJOJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9FO3/c10-7-4-6(7)9(13)2-1-5(11)3-8(9)12/h1-3,6-7,11,13H,4H2.
What are the key properties of 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one?
6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one has a molecular weight of 184.17 g/mol, XLogP of 0.66, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-fluorocyclopropyl)-3,6-dihydroxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 67802332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).