About 2,3-bis(prop-2-enyl)-2,3-dihydropyridine
2,3-bis(prop-2-enyl)-2,3-dihydropyridine (PubChem CID 67802550) has the molecular formula C11H15N
and a molecular weight of 161.25 g/mol. Its IUPAC name is 2,3-bis(prop-2-enyl)-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2,3-bis(prop-2-enyl)-2,3-dihydropyridine |
| PubChem CID | 67802550 |
| Molecular Formula | C11H15N |
| Molecular Weight | 161.25 g/mol |
| Exact Mass | 161.12 |
| IUPAC Name | 2,3-bis(prop-2-enyl)-2,3-dihydropyridine |
| SMILES | C=CCC1C=CC=NC1CC=C |
| InChI | InChI=1S/C11H15N/c1-3-6-10-8-5-9-12-11(10)7-4-2/h3-5,8-11H,1-2,6-7H2 |
| InChIKey | WSUCVRGESOLLNJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.25 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(prop-2-enyl)-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(prop-2-enyl)-2,3-dihydropyridine?
The IUPAC name of 2,3-bis(prop-2-enyl)-2,3-dihydropyridine (CID 67802550) is 2,3-bis(prop-2-enyl)-2,3-dihydropyridine.
What is the SMILES notation for 2,3-bis(prop-2-enyl)-2,3-dihydropyridine?
The canonical SMILES for 2,3-bis(prop-2-enyl)-2,3-dihydropyridine is C=CCC1C=CC=NC1CC=C.
What is the InChIKey of 2,3-bis(prop-2-enyl)-2,3-dihydropyridine?
The InChIKey is WSUCVRGESOLLNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N/c1-3-6-10-8-5-9-12-11(10)7-4-2/h3-5,8-11H,1-2,6-7H2.
What are the key properties of 2,3-bis(prop-2-enyl)-2,3-dihydropyridine?
2,3-bis(prop-2-enyl)-2,3-dihydropyridine has a molecular weight of 161.25 g/mol, XLogP of 2.76, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(prop-2-enyl)-2,3-dihydropyridine is sourced from PubChem (CID 67802550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).