About ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate
ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate (PubChem CID 67802665) has the molecular formula C18H22F2O4
and a molecular weight of 340.37 g/mol. Its IUPAC name is ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate |
| PubChem CID | 67802665 |
| Molecular Formula | C18H22F2O4 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1(C(OC2CCCCO2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H22F2O4/c1-2-22-17(21)18(8-9-18)16(24-15-5-3-4-10-23-15)13-7-6-12(19)11-14(13)20/h6-7,11,15-16H,2-5,8-10H2,1H3 |
| InChIKey | XFHJBFDDBMFKBE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate?
The IUPAC name of ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate (CID 67802665) is ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate.
What is the SMILES notation for ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate?
The canonical SMILES for ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate is CCOC(=O)C1(C(OC2CCCCO2)c2ccc(F)cc2F)CC1.
What is the InChIKey of ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate?
The InChIKey is XFHJBFDDBMFKBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2O4/c1-2-22-17(21)18(8-9-18)16(24-15-5-3-4-10-23-15)13-7-6-12(19)11-14(13)20/h6-7,11,15-16H,2-5,8-10H2,1H3.
What are the key properties of ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate?
ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate has a molecular weight of 340.37 g/mol, XLogP of 3.89, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropane-1-carboxylate is sourced from PubChem (CID 67802665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).