C20H30N2O5 — CID 67802755
carbonic acid;N-cyclohexyl-4-(piperidin-4-ylmethoxy)benzamide (PubChem CID 67802755) has the molecular formula C20H30N2O5 and a molecular weight of 378.47 g/mol. Its IUPAC name is carbonic acid;N-cyclohexyl-4-(piperidin-4-ylmethoxy)benzamide.
| Compound Name | carbonic acid;N-cyclohexyl-4-(piperidin-4-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 67802755 |
| Molecular Formula | C20H30N2O5 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | carbonic acid;N-cyclohexyl-4-(piperidin-4-ylmethoxy)benzamide |
| SMILES | O=C(NC1CCCCC1)c1ccc(OCC2CCNCC2)cc1.O=C(O)O |
| InChI | InChI=1S/C19H28N2O2.CH2O3/c22-19(21-17-4-2-1-3-5-17)16-6-8-18(9-7-16)23-14-15-10-12-20-13-11-15;2-1(3)4/h6-9,15,17,20H,1-5,10-14H2,(H,21,22);(H2,2,3,4) |
| InChIKey | QFUVSPGIJBTACQ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |