C22H37N3O4 — CID 67802926
methyl 3-[1-[4-(piperidine-4-carbonylamino)cyclohexanecarbonyl]piperidin-4-yl]propanoate (PubChem CID 67802926) has the molecular formula C22H37N3O4 and a molecular weight of 407.56 g/mol. Its IUPAC name is methyl 3-[1-[4-(piperidine-4-carbonylamino)cyclohexanecarbonyl]piperidin-4-yl]propanoate.
| Compound Name | methyl 3-[1-[4-(piperidine-4-carbonylamino)cyclohexanecarbonyl]piperidin-4-yl]propanoate |
|---|---|
| PubChem CID | 67802926 |
| Molecular Formula | C22H37N3O4 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | methyl 3-[1-[4-(piperidine-4-carbonylamino)cyclohexanecarbonyl]piperidin-4-yl]propanoate |
| SMILES | COC(=O)CCC1CCN(C(=O)C2CCC(NC(=O)C3CCNCC3)CC2)CC1 |
| InChI | InChI=1S/C22H37N3O4/c1-29-20(26)7-2-16-10-14-25(15-11-16)22(28)18-3-5-19(6-4-18)24-21(27)17-8-12-23-13-9-17/h16-19,23H,2-15H2,1H3,(H,24,27) |
| InChIKey | ZOSFLOSLYDWNFF-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |