About 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one
1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one (PubChem CID 67803276) has the molecular formula C18H22F2O3
and a molecular weight of 324.37 g/mol. Its IUPAC name is 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one.
Molecular Properties
| Compound Name | 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one |
| PubChem CID | 67803276 |
| Molecular Formula | C18H22F2O3 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one |
| SMILES | CCC(=O)C1(C(OC2CCCCO2)c2ccc(F)cc2F)CC1 |
| InChI | InChI=1S/C18H22F2O3/c1-2-15(21)18(8-9-18)17(23-16-5-3-4-10-22-16)13-7-6-12(19)11-14(13)20/h6-7,11,16-17H,2-5,8-10H2,1H3 |
| InChIKey | DZOOTMFXFUDHJU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one?
The IUPAC name of 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one (CID 67803276) is 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one.
What is the SMILES notation for 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one?
The canonical SMILES for 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one is CCC(=O)C1(C(OC2CCCCO2)c2ccc(F)cc2F)CC1.
What is the InChIKey of 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one?
The InChIKey is DZOOTMFXFUDHJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22F2O3/c1-2-15(21)18(8-9-18)17(23-16-5-3-4-10-22-16)13-7-6-12(19)11-14(13)20/h6-7,11,16-17H,2-5,8-10H2,1H3.
What are the key properties of 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one?
1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one has a molecular weight of 324.37 g/mol, XLogP of 4.31, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(2,4-difluorophenyl)-(oxan-2-yloxy)methyl]cyclopropyl]propan-1-one is sourced from PubChem (CID 67803276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).