C14H28N2O — CID 67803331
piperidin-4-one;2,2,6,6-tetramethylpiperidine (PubChem CID 67803331) has the molecular formula C14H28N2O and a molecular weight of 240.39 g/mol. Its IUPAC name is piperidin-4-one;2,2,6,6-tetramethylpiperidine.
| Compound Name | piperidin-4-one;2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 67803331 |
| Molecular Formula | C14H28N2O |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.22 |
| IUPAC Name | piperidin-4-one;2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1.O=C1CCNCC1 |
| InChI | InChI=1S/C9H19N.C5H9NO/c1-8(2)6-5-7-9(3,4)10-8;7-5-1-3-6-4-2-5/h10H,5-7H2,1-4H3;6H,1-4H2 |
| InChIKey | YOEXVTUSBVEHDL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |