C23H28O6 — CID 67803695
(2R,3S,4R,5R)-1-[3-ethyl-8-(4-methylphenyl)-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene]hexane-1,2,3,4,5,6-hexol (PubChem CID 67803695) has the molecular formula C23H28O6 and a molecular weight of 400.47 g/mol. Its IUPAC name is (2R,3S,4R,5R)-1-[3-ethyl-8-(4-methylphenyl)-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene]hexane-1,2,3,4,5,6-hexol.
| Compound Name | (2R,3S,4R,5R)-1-[3-ethyl-8-(4-methylphenyl)-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene]hexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 67803695 |
| Molecular Formula | C23H28O6 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.19 |
| IUPAC Name | (2R,3S,4R,5R)-1-[3-ethyl-8-(4-methylphenyl)-7-bicyclo[4.2.0]octa-1(6),2,4-trienylidene]hexane-1,2,3,4,5,6-hexol |
| SMILES | CCc1ccc2c(c1)C(c1ccc(C)cc1)C2=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C23H28O6/c1-3-13-6-9-15-16(10-13)18(14-7-4-12(2)5-8-14)19(15)21(27)23(29)22(28)20(26)17(25)11-24/h4-10,17-18,20,22-29H,3,11H2,1-2H3/t17-,18?,20-,22+,23+/m1/s1 |
| InChIKey | KPKAYYALXDLPEH-DLBQSYEISA-N |
| XLogP | 1.41 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|