C27H31N3O9 — CID 67804198
bis(but-2-enedioic acid);8-methoxy-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine (PubChem CID 67804198) has the molecular formula C27H31N3O9 and a molecular weight of 541.56 g/mol. Its IUPAC name is bis(but-2-enedioic acid);8-methoxy-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine.
| Compound Name | bis(but-2-enedioic acid);8-methoxy-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine |
|---|---|
| PubChem CID | 67804198 |
| Molecular Formula | C27H31N3O9 |
| Molecular Weight | 541.56 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | bis(but-2-enedioic acid);8-methoxy-11-(1-methylpiperidin-4-ylidene)-5,6-dihydroimidazo[2,1-b][3]benzazepine |
| SMILES | COc1ccc2c(c1)CCn1ccnc1C2=C1CCN(C)CC1.O=C(O)C=CC(=O)O.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C19H23N3O.2C4H4O4/c1-21-9-5-14(6-10-21)18-17-4-3-16(23-2)13-15(17)7-11-22-12-8-20-19(18)22;2*5-3(6)1-2-4(7)8/h3-4,8,12-13H,5-7,9-11H2,1-2H3;2*1-2H,(H,5,6)(H,7,8) |
| InChIKey | KCKRTRPVCWAAKW-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 179.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|