C13H19ClN2O2 — CID 67804532
N-[3-[[(2S)-pyrrolidin-2-yl]methoxy]phenyl]acetamide;hydrochloride (PubChem CID 67804532) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is N-[3-[[(2S)-pyrrolidin-2-yl]methoxy]phenyl]acetamide;hydrochloride.
| Compound Name | N-[3-[[(2S)-pyrrolidin-2-yl]methoxy]phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 67804532 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | N-[3-[[(2S)-pyrrolidin-2-yl]methoxy]phenyl]acetamide;hydrochloride |
| SMILES | CC(=O)Nc1cccc(OC[C@@H]2CCCN2)c1.Cl |
| InChI | InChI=1S/C13H18N2O2.ClH/c1-10(16)15-11-4-2-6-13(8-11)17-9-12-5-3-7-14-12;/h2,4,6,8,12,14H,3,5,7,9H2,1H3,(H,15,16);1H/t12-;/m0./s1 |
| InChIKey | FHBSVBQMZPJEBA-YDALLXLXSA-N |
| XLogP | 2.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |