About 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole
2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole (PubChem CID 67804837) has the molecular formula C24H30N2O
and a molecular weight of 362.52 g/mol. Its IUPAC name is 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole.
Molecular Properties
| Compound Name | 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole |
| PubChem CID | 67804837 |
| Molecular Formula | C24H30N2O |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.24 |
| IUPAC Name | 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole |
| SMILES | CC1(C)CCC(OCCc2cccc3ccccc23)C(Cc2ncc[nH]2)C1 |
| InChI | InChI=1S/C24H30N2O/c1-24(2)12-10-22(20(17-24)16-23-25-13-14-26-23)27-15-11-19-8-5-7-18-6-3-4-9-21(18)19/h3-9,13-14,20,22H,10-12,15-17H2,1-2H3,(H,25,26) |
| InChIKey | ZTCBAJFGRLFFFB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole?
The IUPAC name of 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole (CID 67804837) is 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole.
What is the SMILES notation for 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole?
The canonical SMILES for 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole is CC1(C)CCC(OCCc2cccc3ccccc23)C(Cc2ncc[nH]2)C1.
What is the InChIKey of 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole?
The InChIKey is ZTCBAJFGRLFFFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O/c1-24(2)12-10-22(20(17-24)16-23-25-13-14-26-23)27-15-11-19-8-5-7-18-6-3-4-9-21(18)19/h3-9,13-14,20,22H,10-12,15-17H2,1-2H3,(H,25,26).
What are the key properties of 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole?
2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole has a molecular weight of 362.52 g/mol, XLogP of 5.56, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[5,5-dimethyl-2-(2-naphthalen-1-ylethoxy)cyclohexyl]methyl]-1H-imidazole is sourced from PubChem (CID 67804837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).