C12H20N2 — CID 67804903
1-pentyl-2,3,3a,4-tetrahydroindazole (PubChem CID 67804903) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-pentyl-2,3,3a,4-tetrahydroindazole.
| Compound Name | 1-pentyl-2,3,3a,4-tetrahydroindazole |
|---|---|
| PubChem CID | 67804903 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-pentyl-2,3,3a,4-tetrahydroindazole |
| SMILES | CCCCCN1NCC2CC=CC=C21 |
| InChI | InChI=1S/C12H20N2/c1-2-3-6-9-14-12-8-5-4-7-11(12)10-13-14/h4-5,8,11,13H,2-3,6-7,9-10H2,1H3 |
| InChIKey | DFHHYZSCHUSSMQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|