C20H35N3 — CID 67805125
5-[(5,5-dimethyl-2-non-1-enylcyclohexyl)methyl]-1H-1,2,4-triazole (PubChem CID 67805125) has the molecular formula C20H35N3 and a molecular weight of 317.52 g/mol. Its IUPAC name is 5-[(5,5-dimethyl-2-non-1-enylcyclohexyl)methyl]-1H-1,2,4-triazole.
| Compound Name | 5-[(5,5-dimethyl-2-non-1-enylcyclohexyl)methyl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 67805125 |
| Molecular Formula | C20H35N3 |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.28 |
| IUPAC Name | 5-[(5,5-dimethyl-2-non-1-enylcyclohexyl)methyl]-1H-1,2,4-triazole |
| SMILES | CCCCCCCC=CC1CCC(C)(C)CC1Cc1ncn[nH]1 |
| InChI | InChI=1S/C20H35N3/c1-4-5-6-7-8-9-10-11-17-12-13-20(2,3)15-18(17)14-19-21-16-22-23-19/h10-11,16-18H,4-9,12-15H2,1-3H3,(H,21,22,23) |
| InChIKey | JKYMONQKYZVKCS-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|