C15H28N2 — CID 67805187
1,5-ditert-butyl-3-methylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 67805187) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is 1,5-ditert-butyl-3-methylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 1,5-ditert-butyl-3-methylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 67805187 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | 1,5-ditert-butyl-3-methylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | CC1=CC(C(C)(C)C)=CC(N)(C(C)(C)C)C1N |
| InChI | InChI=1S/C15H28N2/c1-10-8-11(13(2,3)4)9-15(17,12(10)16)14(5,6)7/h8-9,12H,16-17H2,1-7H3 |
| InChIKey | PQAVPDGIJLIWCR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |