About ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate
ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate (PubChem CID 67805230) has the molecular formula C26H25N3O3
and a molecular weight of 427.50 g/mol. Its IUPAC name is ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate.
Molecular Properties
| Compound Name | ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate |
| PubChem CID | 67805230 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate |
| SMILES | CCOC(=O)CC(O)c1ncnn1C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O3/c1-2-32-24(31)18-23(30)25-27-19-28-29(25)26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,19,23,30H,2,18H2,1H3 |
| InChIKey | WNIKPIOEBWASMN-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate?
The IUPAC name of ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate (CID 67805230) is ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate.
What is the SMILES notation for ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate?
The canonical SMILES for ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate is CCOC(=O)CC(O)c1ncnn1C(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate?
The InChIKey is WNIKPIOEBWASMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O3/c1-2-32-24(31)18-23(30)25-27-19-28-29(25)26(20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-17,19,23,30H,2,18H2,1H3.
What are the key properties of ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate?
ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate has a molecular weight of 427.50 g/mol, XLogP of 4.10, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-hydroxy-3-(2-trityl-1,2,4-triazol-3-yl)propanoate is sourced from PubChem (CID 67805230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).