C27H37NO3 — CID 67806258
N-[[2-hexoxy-5-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]methyl]prop-2-enamide (PubChem CID 67806258) has the molecular formula C27H37NO3 and a molecular weight of 423.60 g/mol. Its IUPAC name is N-[[2-hexoxy-5-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]methyl]prop-2-enamide.
| Compound Name | N-[[2-hexoxy-5-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 67806258 |
| Molecular Formula | C27H37NO3 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.28 |
| IUPAC Name | N-[[2-hexoxy-5-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(C=C2C(=O)C3(C)CCC2C3(C)C)ccc1OCCCCCC |
| InChI | InChI=1S/C27H37NO3/c1-6-8-9-10-15-31-23-12-11-19(16-20(23)18-28-24(29)7-2)17-21-22-13-14-27(5,25(21)30)26(22,3)4/h7,11-12,16-17,22H,2,6,8-10,13-15,18H2,1,3-5H3,(H,28,29) |
| InChIKey | DWDGXRJZDYMQSX-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|