About 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine
3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine (PubChem CID 67806986) has the molecular formula C18H15Cl2N5
and a molecular weight of 372.26 g/mol. Its IUPAC name is 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine.
Molecular Properties
| Compound Name | 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine |
| PubChem CID | 67806986 |
| Molecular Formula | C18H15Cl2N5 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine |
| SMILES | Cc1nccn1CCn1nc(-c2ccc(Cl)c(Cl)c2)c2cnccc21 |
| InChI | InChI=1S/C18H15Cl2N5/c1-12-22-6-7-24(12)8-9-25-17-4-5-21-11-14(17)18(23-25)13-2-3-15(19)16(20)10-13/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | XBJAVYLZUINWMX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine?
The IUPAC name of 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine (CID 67806986) is 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine.
What is the SMILES notation for 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine?
The canonical SMILES for 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine is Cc1nccn1CCn1nc(-c2ccc(Cl)c(Cl)c2)c2cnccc21.
What is the InChIKey of 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine?
The InChIKey is XBJAVYLZUINWMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Cl2N5/c1-12-22-6-7-24(12)8-9-25-17-4-5-21-11-14(17)18(23-25)13-2-3-15(19)16(20)10-13/h2-7,10-11H,8-9H2,1H3.
What are the key properties of 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine?
3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine has a molecular weight of 372.26 g/mol, XLogP of 4.61, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dichlorophenyl)-1-[2-(2-methylimidazol-1-yl)ethyl]pyrazolo[4,3-c]pyridine is sourced from PubChem (CID 67806986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).