About 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide
2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide (PubChem CID 67807083) has the molecular formula C9H16N2O3S2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide |
| PubChem CID | 67807083 |
| Molecular Formula | C9H16N2O3S2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide |
| SMILES | NS(=O)(=O)c1cnc(CCCCCCO)s1 |
| InChI | InChI=1S/C9H16N2O3S2/c10-16(13,14)9-7-11-8(15-9)5-3-1-2-4-6-12/h7,12H,1-6H2,(H2,10,13,14) |
| InChIKey | GKMHCURLLWBXRR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide (CID 67807083) is 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide is NS(=O)(=O)c1cnc(CCCCCCO)s1.
What is the InChIKey of 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide?
The InChIKey is GKMHCURLLWBXRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O3S2/c10-16(13,14)9-7-11-8(15-9)5-3-1-2-4-6-12/h7,12H,1-6H2,(H2,10,13,14).
What are the key properties of 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide?
2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide has a molecular weight of 264.37 g/mol, XLogP of 0.89, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-hydroxyhexyl)-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 67807083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).