C19H10N4O3 — CID 67807092
5-hydroxy-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,3,6,8,10,15,17,19,21-nonaene-12,14-dione (PubChem CID 67807092) has the molecular formula C19H10N4O3 and a molecular weight of 342.31 g/mol. Its IUPAC name is 5-hydroxy-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,3,6,8,10,15,17,19,21-nonaene-12,14-dione.
| Compound Name | 5-hydroxy-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,3,6,8,10,15,17,19,21-nonaene-12,14-dione |
|---|---|
| PubChem CID | 67807092 |
| Molecular Formula | C19H10N4O3 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 5-hydroxy-3,5,13,23-tetrazahexacyclo[14.7.0.02,10.04,9.011,15.017,22]tricosa-1,3,6,8,10,15,17,19,21-nonaene-12,14-dione |
| SMILES | O=C1NC(=O)c2c1c1c3cccn(O)c-3nc1c1[nH]c3ccccc3c21 |
| InChI | InChI=1S/C19H10N4O3/c24-18-13-11-8-4-1-2-6-10(8)20-15(11)16-12(14(13)19(25)22-18)9-5-3-7-23(26)17(9)21-16/h1-7,20,26H,(H,22,24,25) |
| InChIKey | MTYAIGZMEACLIV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|