About 1-(2-tert-butylphenyl)-2,3-dichlorobenzene
1-(2-tert-butylphenyl)-2,3-dichlorobenzene (PubChem CID 67807125) has the molecular formula C16H16Cl2
and a molecular weight of 279.21 g/mol. Its IUPAC name is 1-(2-tert-butylphenyl)-2,3-dichlorobenzene.
Molecular Properties
| Compound Name | 1-(2-tert-butylphenyl)-2,3-dichlorobenzene |
| PubChem CID | 67807125 |
| Molecular Formula | C16H16Cl2 |
| Molecular Weight | 279.21 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1-(2-tert-butylphenyl)-2,3-dichlorobenzene |
| SMILES | CC(C)(C)c1ccccc1-c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16Cl2/c1-16(2,3)13-9-5-4-7-11(13)12-8-6-10-14(17)15(12)18/h4-10H,1-3H3 |
| InChIKey | VEWISMYCVCPKQY-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.21 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2-tert-butylphenyl)-2,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-tert-butylphenyl)-2,3-dichlorobenzene?
The IUPAC name of 1-(2-tert-butylphenyl)-2,3-dichlorobenzene (CID 67807125) is 1-(2-tert-butylphenyl)-2,3-dichlorobenzene.
What is the SMILES notation for 1-(2-tert-butylphenyl)-2,3-dichlorobenzene?
The canonical SMILES for 1-(2-tert-butylphenyl)-2,3-dichlorobenzene is CC(C)(C)c1ccccc1-c1cccc(Cl)c1Cl.
What is the InChIKey of 1-(2-tert-butylphenyl)-2,3-dichlorobenzene?
The InChIKey is VEWISMYCVCPKQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16Cl2/c1-16(2,3)13-9-5-4-7-11(13)12-8-6-10-14(17)15(12)18/h4-10H,1-3H3.
What are the key properties of 1-(2-tert-butylphenyl)-2,3-dichlorobenzene?
1-(2-tert-butylphenyl)-2,3-dichlorobenzene has a molecular weight of 279.21 g/mol, XLogP of 5.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-tert-butylphenyl)-2,3-dichlorobenzene is sourced from PubChem (CID 67807125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).