About (5S,6R)-5,6-diphenylpiperidin-2-one
(5S,6R)-5,6-diphenylpiperidin-2-one (PubChem CID 67807202) has the molecular formula C17H17NO
and a molecular weight of 251.33 g/mol. Its IUPAC name is (5S,6R)-5,6-diphenylpiperidin-2-one.
Molecular Properties
| Compound Name | (5S,6R)-5,6-diphenylpiperidin-2-one |
| PubChem CID | 67807202 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (5S,6R)-5,6-diphenylpiperidin-2-one |
| SMILES | O=C1CC[C@@H](c2ccccc2)[C@H](c2ccccc2)N1 |
| InChI | InChI=1S/C17H17NO/c19-16-12-11-15(13-7-3-1-4-8-13)17(18-16)14-9-5-2-6-10-14/h1-10,15,17H,11-12H2,(H,18,19)/t15-,17-/m0/s1 |
| InChIKey | OBPONSFZJGNQCA-RDJZCZTQSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (5S,6R)-5,6-diphenylpiperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,6R)-5,6-diphenylpiperidin-2-one?
The IUPAC name of (5S,6R)-5,6-diphenylpiperidin-2-one (CID 67807202) is (5S,6R)-5,6-diphenylpiperidin-2-one.
What is the SMILES notation for (5S,6R)-5,6-diphenylpiperidin-2-one?
The canonical SMILES for (5S,6R)-5,6-diphenylpiperidin-2-one is O=C1CC[C@@H](c2ccccc2)[C@H](c2ccccc2)N1.
What is the InChIKey of (5S,6R)-5,6-diphenylpiperidin-2-one?
The InChIKey is OBPONSFZJGNQCA-RDJZCZTQSA-N. The full InChI is InChI=1S/C17H17NO/c19-16-12-11-15(13-7-3-1-4-8-13)17(18-16)14-9-5-2-6-10-14/h1-10,15,17H,11-12H2,(H,18,19)/t15-,17-/m0/s1.
What are the key properties of (5S,6R)-5,6-diphenylpiperidin-2-one?
(5S,6R)-5,6-diphenylpiperidin-2-one has a molecular weight of 251.33 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,6R)-5,6-diphenylpiperidin-2-one is sourced from PubChem (CID 67807202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).