About 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide
5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide (PubChem CID 67807469) has the molecular formula C11H23NO3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide.
Analyze 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide?
The IUPAC name of 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide (CID 67807469) is 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide.
What is the SMILES notation for 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide?
The canonical SMILES for 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide is CC(C)CCOC1CCN(C(C)C)S1(=O)=O.
What is the InChIKey of 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide?
The InChIKey is CEDOUBBHJJPUCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO3S/c1-9(2)6-8-15-11-5-7-12(10(3)4)16(11,13)14/h9-11H,5-8H2,1-4H3.
What are the key properties of 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide?
5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide has a molecular weight of 249.38 g/mol, XLogP of 1.82, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-methylbutoxy)-2-propan-2-yl-1,2-thiazolidine 1,1-dioxide is sourced from PubChem (CID 67807469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).