About (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol
(3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol (PubChem CID 67807670) has the molecular formula C13H26F2N2O
and a molecular weight of 264.36 g/mol. Its IUPAC name is (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol.
Molecular Properties
| Compound Name | (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol |
| PubChem CID | 67807670 |
| Molecular Formula | C13H26F2N2O |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol |
| SMILES | CN(C)CC(F)(F)[C@H](O)[C@@H](N)CC1CCCCC1 |
| InChI | InChI=1S/C13H26F2N2O/c1-17(2)9-13(14,15)12(18)11(16)8-10-6-4-3-5-7-10/h10-12,18H,3-9,16H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | FWMGJOVEDQUODX-NWDGAFQWSA-N |
| XLogP | 1.84 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol?
The IUPAC name of (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol (CID 67807670) is (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol.
What is the SMILES notation for (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol?
The canonical SMILES for (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol is CN(C)CC(F)(F)[C@H](O)[C@@H](N)CC1CCCCC1.
What is the InChIKey of (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol?
The InChIKey is FWMGJOVEDQUODX-NWDGAFQWSA-N. The full InChI is InChI=1S/C13H26F2N2O/c1-17(2)9-13(14,15)12(18)11(16)8-10-6-4-3-5-7-10/h10-12,18H,3-9,16H2,1-2H3/t11-,12+/m0/s1.
What are the key properties of (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol?
(3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol has a molecular weight of 264.36 g/mol, XLogP of 1.84, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-amino-5-cyclohexyl-1-(dimethylamino)-2,2-difluoropentan-3-ol is sourced from PubChem (CID 67807670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).