About 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid
2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 67807692) has the molecular formula C8H8Cl2O3
and a molecular weight of 223.06 g/mol. Its IUPAC name is 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid.
Molecular Properties
| Compound Name | 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid |
| PubChem CID | 67807692 |
| Molecular Formula | C8H8Cl2O3 |
| Molecular Weight | 223.06 g/mol |
| Exact Mass | 221.99 |
| IUPAC Name | 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | COC1(C(=O)O)C(Cl)=CC=CC1Cl |
| InChI | InChI=1S/C8H8Cl2O3/c1-13-8(7(11)12)5(9)3-2-4-6(8)10/h2-5H,1H3,(H,11,12) |
| InChIKey | NXXCACSSVIEAKM-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.06 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid (CID 67807692) is 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid is COC1(C(=O)O)C(Cl)=CC=CC1Cl.
What is the InChIKey of 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is NXXCACSSVIEAKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O3/c1-13-8(7(11)12)5(9)3-2-4-6(8)10/h2-5H,1H3,(H,11,12).
What are the key properties of 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid?
2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 223.06 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichloro-1-methoxycyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 67807692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).