About (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid
(2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid (PubChem CID 67808227) has the molecular formula C20H29NO6S
and a molecular weight of 411.52 g/mol. Its IUPAC name is (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid.
Molecular Properties
| Compound Name | (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid |
| PubChem CID | 67808227 |
| Molecular Formula | C20H29NO6S |
| Molecular Weight | 411.52 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid |
| SMILES | CC1CN(C(=O)C(C)(C)S(=O)(=O)C[C@@H](Cc2ccccc2)C(=O)O)CC(C)O1 |
| InChI | InChI=1S/C20H29NO6S/c1-14-11-21(12-15(2)27-14)19(24)20(3,4)28(25,26)13-17(18(22)23)10-16-8-6-5-7-9-16/h5-9,14-15,17H,10-13H2,1-4H3,(H,22,23)/t14?,15?,17-/m1/s1 |
| InChIKey | YXXMSOWBOQHKDL-VMBOVVBDSA-N |
| XLogP | 1.76 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.52 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid?
The IUPAC name of (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid (CID 67808227) is (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid.
What is the SMILES notation for (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid?
The canonical SMILES for (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid is CC1CN(C(=O)C(C)(C)S(=O)(=O)C[C@@H](Cc2ccccc2)C(=O)O)CC(C)O1.
What is the InChIKey of (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid?
The InChIKey is YXXMSOWBOQHKDL-VMBOVVBDSA-N. The full InChI is InChI=1S/C20H29NO6S/c1-14-11-21(12-15(2)27-14)19(24)20(3,4)28(25,26)13-17(18(22)23)10-16-8-6-5-7-9-16/h5-9,14-15,17H,10-13H2,1-4H3,(H,22,23)/t14?,15?,17-/m1/s1.
What are the key properties of (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid?
(2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid has a molecular weight of 411.52 g/mol, XLogP of 1.76, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-benzyl-3-[1-(2,6-dimethylmorpholin-4-yl)-2-methyl-1-oxopropan-2-yl]sulfonylpropanoic acid is sourced from PubChem (CID 67808227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).