About 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid
2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid (PubChem CID 67808649) has the molecular formula C12H6Cl4N2O4
and a molecular weight of 384.00 g/mol. Its IUPAC name is 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid.
Molecular Properties
| Compound Name | 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid |
| PubChem CID | 67808649 |
| Molecular Formula | C12H6Cl4N2O4 |
| Molecular Weight | 384.00 g/mol |
| Exact Mass | 381.91 |
| IUPAC Name | 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid |
| SMILES | O=C(O)c1cc(-n2c(=O)cc(C(Cl)(Cl)Cl)[nH]c2=O)ccc1Cl |
| InChI | InChI=1S/C12H6Cl4N2O4/c13-7-2-1-5(3-6(7)10(20)21)18-9(19)4-8(12(14,15)16)17-11(18)22/h1-4H,(H,17,22)(H,20,21) |
| InChIKey | AMGZVFHMEHGSRK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 92.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.00 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid?
The IUPAC name of 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid (CID 67808649) is 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid.
What is the SMILES notation for 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid?
The canonical SMILES for 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid is O=C(O)c1cc(-n2c(=O)cc(C(Cl)(Cl)Cl)[nH]c2=O)ccc1Cl.
What is the InChIKey of 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid?
The InChIKey is AMGZVFHMEHGSRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Cl4N2O4/c13-7-2-1-5(3-6(7)10(20)21)18-9(19)4-8(12(14,15)16)17-11(18)22/h1-4H,(H,17,22)(H,20,21).
What are the key properties of 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid?
2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid has a molecular weight of 384.00 g/mol, XLogP of 2.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-[2,4-dioxo-6-(trichloromethyl)-1H-pyrimidin-3-yl]benzoic acid is sourced from PubChem (CID 67808649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).