C20H22FN3O5 — CID 67809327
(1S,5S,8aS,8bR)-5-[(4-fluorophenyl)carbamoylamino]-1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid (PubChem CID 67809327) has the molecular formula C20H22FN3O5 and a molecular weight of 403.41 g/mol. Its IUPAC name is (1S,5S,8aS,8bR)-5-[(4-fluorophenyl)carbamoylamino]-1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid.
| Compound Name | (1S,5S,8aS,8bR)-5-[(4-fluorophenyl)carbamoylamino]-1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 67809327 |
| Molecular Formula | C20H22FN3O5 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | (1S,5S,8aS,8bR)-5-[(4-fluorophenyl)carbamoylamino]-1-(1-hydroxyethyl)-2-oxo-5,6,7,8,8a,8b-hexahydro-1H-azeto[1,2-b]isoindole-4-carboxylic acid |
| SMILES | CC(O)[C@H]1C(=O)N2C(C(=O)O)=C3[C@@H](NC(=O)Nc4ccc(F)cc4)CCC[C@@H]3[C@H]12 |
| InChI | InChI=1S/C20H22FN3O5/c1-9(25)14-16-12-3-2-4-13(15(12)17(19(27)28)24(16)18(14)26)23-20(29)22-11-7-5-10(21)6-8-11/h5-9,12-14,16,25H,2-4H2,1H3,(H,27,28)(H2,22,23,29)/t9?,12-,13-,14+,16+/m0/s1 |
| InChIKey | CVRUCZJNXWPNAH-NRALPXGJSA-N |
| XLogP | 1.68 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |