About 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine
2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine (PubChem CID 67809443) has the molecular formula C7H7Br2N
and a molecular weight of 264.95 g/mol. Its IUPAC name is 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine |
| PubChem CID | 67809443 |
| Molecular Formula | C7H7Br2N |
| Molecular Weight | 264.95 g/mol |
| Exact Mass | 262.89 |
| IUPAC Name | 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine |
| SMILES | [H]/N=C1/C(Br)=CC(C)=CC1Br |
| InChI | InChI=1S/C7H7Br2N/c1-4-2-5(8)7(10)6(9)3-4/h2-3,5,10H,1H3/b10-7+ |
| InChIKey | RHGLBASCTOXLLT-JXMROGBWSA-N |
| XLogP | 3.01 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.95 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine?
The IUPAC name of 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine (CID 67809443) is 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine.
What is the SMILES notation for 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine?
The canonical SMILES for 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine is [H]/N=C1/C(Br)=CC(C)=CC1Br.
What is the InChIKey of 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine?
The InChIKey is RHGLBASCTOXLLT-JXMROGBWSA-N. The full InChI is InChI=1S/C7H7Br2N/c1-4-2-5(8)7(10)6(9)3-4/h2-3,5,10H,1H3/b10-7+.
What are the key properties of 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine?
2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine has a molecular weight of 264.95 g/mol, XLogP of 3.01, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dibromo-4-methylcyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 67809443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).