C27H46O5 — CID 67810189
2-(oxan-2-yloxy)oxane;3,7,11-trimethyldodeca-2,6,10-trienyl acetate (PubChem CID 67810189) has the molecular formula C27H46O5 and a molecular weight of 450.66 g/mol. Its IUPAC name is 2-(oxan-2-yloxy)oxane;3,7,11-trimethyldodeca-2,6,10-trienyl acetate.
| Compound Name | 2-(oxan-2-yloxy)oxane;3,7,11-trimethyldodeca-2,6,10-trienyl acetate |
|---|---|
| PubChem CID | 67810189 |
| Molecular Formula | C27H46O5 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | 2-(oxan-2-yloxy)oxane;3,7,11-trimethyldodeca-2,6,10-trienyl acetate |
| SMILES | C1CCC(OC2CCCCO2)OC1.CC(=O)OCC=C(C)CCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C17H28O2.C10H18O3/c1-14(2)8-6-9-15(3)10-7-11-16(4)12-13-19-17(5)18;1-3-7-11-9(5-1)13-10-6-2-4-8-12-10/h8,10,12H,6-7,9,11,13H2,1-5H3;9-10H,1-8H2 |
| InChIKey | IJILBOFDBWXGKC-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|