About ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene
ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene (PubChem CID 67811623) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene.
Molecular Properties
| Compound Name | ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene |
| PubChem CID | 67811623 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene |
| SMILES | C=C(C)C1CC=C(C)CC1.OCCO |
| InChI | InChI=1S/C10H16.C2H6O2/c1-8(2)10-6-4-9(3)5-7-10;3-1-2-4/h4,10H,1,5-7H2,2-3H3;3-4H,1-2H2 |
| InChIKey | NRCZXBQFUPDKOU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene?
The IUPAC name of ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene (CID 67811623) is ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene.
What is the SMILES notation for ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene?
The canonical SMILES for ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene is C=C(C)C1CC=C(C)CC1.OCCO.
What is the InChIKey of ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene?
The InChIKey is NRCZXBQFUPDKOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16.C2H6O2/c1-8(2)10-6-4-9(3)5-7-10;3-1-2-4/h4,10H,1,5-7H2,2-3H3;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene?
ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene has a molecular weight of 198.31 g/mol, XLogP of 2.28, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;1-methyl-4-prop-1-en-2-ylcyclohexene is sourced from PubChem (CID 67811623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).