About 4-bromo-2-methoxy-3,5-dimethylpyridine
4-bromo-2-methoxy-3,5-dimethylpyridine (PubChem CID 67811684) has the molecular formula C8H10BrNO
and a molecular weight of 216.08 g/mol. Its IUPAC name is 4-bromo-2-methoxy-3,5-dimethylpyridine.
Molecular Properties
| Compound Name | 4-bromo-2-methoxy-3,5-dimethylpyridine |
| PubChem CID | 67811684 |
| Molecular Formula | C8H10BrNO |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 4-bromo-2-methoxy-3,5-dimethylpyridine |
| SMILES | COc1ncc(C)c(Br)c1C |
| InChI | InChI=1S/C8H10BrNO/c1-5-4-10-8(11-3)6(2)7(5)9/h4H,1-3H3 |
| InChIKey | KYVFSCDQWUULIP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-2-methoxy-3,5-dimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methoxy-3,5-dimethylpyridine?
The IUPAC name of 4-bromo-2-methoxy-3,5-dimethylpyridine (CID 67811684) is 4-bromo-2-methoxy-3,5-dimethylpyridine.
What is the SMILES notation for 4-bromo-2-methoxy-3,5-dimethylpyridine?
The canonical SMILES for 4-bromo-2-methoxy-3,5-dimethylpyridine is COc1ncc(C)c(Br)c1C.
What is the InChIKey of 4-bromo-2-methoxy-3,5-dimethylpyridine?
The InChIKey is KYVFSCDQWUULIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNO/c1-5-4-10-8(11-3)6(2)7(5)9/h4H,1-3H3.
What are the key properties of 4-bromo-2-methoxy-3,5-dimethylpyridine?
4-bromo-2-methoxy-3,5-dimethylpyridine has a molecular weight of 216.08 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methoxy-3,5-dimethylpyridine is sourced from PubChem (CID 67811684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).