C32H33F3N4O5 — CID 67811973
3-[4-(diaminomethylideneamino)phenyl]-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-4-oxo-3H-chromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 67811973) has the molecular formula C32H33F3N4O5 and a molecular weight of 610.63 g/mol. Its IUPAC name is 3-[4-(diaminomethylideneamino)phenyl]-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-4-oxo-3H-chromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | 3-[4-(diaminomethylideneamino)phenyl]-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-4-oxo-3H-chromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 67811973 |
| Molecular Formula | C32H33F3N4O5 |
| Molecular Weight | 610.63 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | 3-[4-(diaminomethylideneamino)phenyl]-N-[4-[2-(6-hydroxy-2,5,7,8-tetramethyl-4-oxo-3H-chromen-2-yl)ethoxy]-3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | Cc1c(C)c2c(c(C)c1O)C(=O)CC(C)(CCOc1ccc(NC(=O)C=Cc3ccc(N=C(N)N)cc3)cc1C(F)(F)F)O2 |
| InChI | InChI=1S/C32H33F3N4O5/c1-17-18(2)29-27(19(3)28(17)42)24(40)16-31(4,44-29)13-14-43-25-11-10-22(15-23(25)32(33,34)35)38-26(41)12-7-20-5-8-21(9-6-20)39-30(36)37/h5-12,15,42H,13-14,16H2,1-4H3,(H,38,41)(H4,36,37,39) |
| InChIKey | KTGKJQCBWIJSHD-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.63 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|