C13H23N3 — CID 67812536
N,N-diethyl-3-(2-ethylpyrimidin-4-yl)propan-1-amine (PubChem CID 67812536) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is N,N-diethyl-3-(2-ethylpyrimidin-4-yl)propan-1-amine.
| Compound Name | N,N-diethyl-3-(2-ethylpyrimidin-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 67812536 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | N,N-diethyl-3-(2-ethylpyrimidin-4-yl)propan-1-amine |
| SMILES | CCc1nccc(CCCN(CC)CC)n1 |
| InChI | InChI=1S/C13H23N3/c1-4-13-14-10-9-12(15-13)8-7-11-16(5-2)6-3/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | ABLFJKCRZIASJF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |